C11H13BrFNO2 — CID 107633429
4-(2-bromo-5-fluoroanilino)pentanoic acid (PubChem CID 107633429) has the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. Its IUPAC name is 4-(2-bromo-5-fluoroanilino)pentanoic acid.
| Compound Name | 4-(2-bromo-5-fluoroanilino)pentanoic acid |
|---|---|
| PubChem CID | 107633429 |
| Molecular Formula | C11H13BrFNO2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-(2-bromo-5-fluoroanilino)pentanoic acid |
| SMILES | CC(CCC(=O)O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H13BrFNO2/c1-7(2-5-11(15)16)14-10-6-8(13)3-4-9(10)12/h3-4,6-7,14H,2,5H2,1H3,(H,15,16) |
| InChIKey | YJFOQBLTZFYUDD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |