C15H23BrFN — CID 107632561
2-bromo-N-(2,6-dimethylheptan-4-yl)-5-fluoroaniline (PubChem CID 107632561) has the molecular formula C15H23BrFN and a molecular weight of 316.26 g/mol. Its IUPAC name is 2-bromo-N-(2,6-dimethylheptan-4-yl)-5-fluoroaniline.
| Compound Name | 2-bromo-N-(2,6-dimethylheptan-4-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 107632561 |
| Molecular Formula | C15H23BrFN |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-bromo-N-(2,6-dimethylheptan-4-yl)-5-fluoroaniline |
| SMILES | CC(C)CC(CC(C)C)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C15H23BrFN/c1-10(2)7-13(8-11(3)4)18-15-9-12(17)5-6-14(15)16/h5-6,9-11,13,18H,7-8H2,1-4H3 |
| InChIKey | MUOLOQKIKOUKGZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |