C14H21BrFN — CID 114279957
2-bromo-N-(5,5-dimethylhexan-2-yl)-5-fluoroaniline (PubChem CID 114279957) has the molecular formula C14H21BrFN and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-bromo-N-(5,5-dimethylhexan-2-yl)-5-fluoroaniline.
| Compound Name | 2-bromo-N-(5,5-dimethylhexan-2-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 114279957 |
| Molecular Formula | C14H21BrFN |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-bromo-N-(5,5-dimethylhexan-2-yl)-5-fluoroaniline |
| SMILES | CC(CCC(C)(C)C)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C14H21BrFN/c1-10(7-8-14(2,3)4)17-13-9-11(16)5-6-12(13)15/h5-6,9-10,17H,7-8H2,1-4H3 |
| InChIKey | LRYUWYQBUJAVRT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |