C10H10BrCl2NO3 — CID 107791298
2-(4-bromo-2,3-dichloroanilino)-3-methoxypropanoic acid (PubChem CID 107791298) has the molecular formula C10H10BrCl2NO3 and a molecular weight of 343.00 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dichloroanilino)-3-methoxypropanoic acid.
| Compound Name | 2-(4-bromo-2,3-dichloroanilino)-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 107791298 |
| Molecular Formula | C10H10BrCl2NO3 |
| Molecular Weight | 343.00 g/mol |
| Exact Mass | 340.92 |
| IUPAC Name | 2-(4-bromo-2,3-dichloroanilino)-3-methoxypropanoic acid |
| SMILES | COCC(Nc1ccc(Br)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C10H10BrCl2NO3/c1-17-4-7(10(15)16)14-6-3-2-5(11)8(12)9(6)13/h2-3,7,14H,4H2,1H3,(H,15,16) |
| InChIKey | ZQSGKYJRDWOJQQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.00 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|