C16H13BrCl2FN — CID 107787702
4-bromo-2,3-dichloro-N-[cyclopropyl-(4-fluorophenyl)methyl]aniline (PubChem CID 107787702) has the molecular formula C16H13BrCl2FN and a molecular weight of 389.10 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-[cyclopropyl-(4-fluorophenyl)methyl]aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-[cyclopropyl-(4-fluorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 107787702 |
| Molecular Formula | C16H13BrCl2FN |
| Molecular Weight | 389.10 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-[cyclopropyl-(4-fluorophenyl)methyl]aniline |
| SMILES | Fc1ccc(C(Nc2ccc(Br)c(Cl)c2Cl)C2CC2)cc1 |
| InChI | InChI=1S/C16H13BrCl2FN/c17-12-7-8-13(15(19)14(12)18)21-16(9-1-2-9)10-3-5-11(20)6-4-10/h3-9,16,21H,1-2H2 |
| InChIKey | PNQAMRFAXKLWDQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.10 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|