About N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine
N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine (PubChem CID 107133309) has the molecular formula C15H24N2S2
and a molecular weight of 296.50 g/mol. Its IUPAC name is N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine |
| PubChem CID | 107133309 |
| Molecular Formula | C15H24N2S2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine |
| SMILES | CC(C)(C)c1csc(C(NC2CC2)C2CCSC2)n1 |
| InChI | InChI=1S/C15H24N2S2/c1-15(2,3)12-9-19-14(17-12)13(16-11-4-5-11)10-6-7-18-8-10/h9-11,13,16H,4-8H2,1-3H3 |
| InChIKey | ALQALNUFUKPMME-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine?
The IUPAC name of N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine (CID 107133309) is N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine.
What is the SMILES notation for N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine?
The canonical SMILES for N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine is CC(C)(C)c1csc(C(NC2CC2)C2CCSC2)n1.
What is the InChIKey of N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine?
The InChIKey is ALQALNUFUKPMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2S2/c1-15(2,3)12-9-19-14(17-12)13(16-11-4-5-11)10-6-7-18-8-10/h9-11,13,16H,4-8H2,1-3H3.
What are the key properties of N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine?
N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine has a molecular weight of 296.50 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-tert-butyl-1,3-thiazol-2-yl)-(thiolan-3-yl)methyl]cyclopropanamine is sourced from PubChem (CID 107133309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).