C11H16N2S2 — CID 107133305
N-[1,3-thiazol-2-yl(thiolan-3-yl)methyl]cyclopropanamine (PubChem CID 107133305) has the molecular formula C11H16N2S2 and a molecular weight of 240.40 g/mol. Its IUPAC name is N-[1,3-thiazol-2-yl(thiolan-3-yl)methyl]cyclopropanamine.
| Compound Name | N-[1,3-thiazol-2-yl(thiolan-3-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 107133305 |
| Molecular Formula | C11H16N2S2 |
| Molecular Weight | 240.40 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | N-[1,3-thiazol-2-yl(thiolan-3-yl)methyl]cyclopropanamine |
| SMILES | c1csc(C(NC2CC2)C2CCSC2)n1 |
| InChI | InChI=1S/C11H16N2S2/c1-2-9(1)13-10(8-3-5-14-7-8)11-12-4-6-15-11/h4,6,8-10,13H,1-3,5,7H2 |
| InChIKey | KMWWGEOILWNHAH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |