C9H14N2OS — CID 46785170
2-[[cyclopropyl(1,3-thiazol-2-yl)methyl]amino]ethanol (PubChem CID 46785170) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-[[cyclopropyl(1,3-thiazol-2-yl)methyl]amino]ethanol.
| Compound Name | 2-[[cyclopropyl(1,3-thiazol-2-yl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 46785170 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-[[cyclopropyl(1,3-thiazol-2-yl)methyl]amino]ethanol |
| SMILES | OCCNC(c1nccs1)C1CC1 |
| InChI | InChI=1S/C9H14N2OS/c12-5-3-10-8(7-1-2-7)9-11-4-6-13-9/h4,6-8,10,12H,1-3,5H2 |
| InChIKey | KLLAIGPQBUPCPK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |