About N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide
N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide (PubChem CID 97219025) has the molecular formula C16H24N4O2S
and a molecular weight of 336.46 g/mol. Its IUPAC name is N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide |
| PubChem CID | 97219025 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide |
| SMILES | O=C(NCCNC(=O)C1CCCC1)N[C@H](c1nccs1)C1CC1 |
| InChI | InChI=1S/C16H24N4O2S/c21-14(12-3-1-2-4-12)17-7-8-19-16(22)20-13(11-5-6-11)15-18-9-10-23-15/h9-13H,1-8H2,(H,17,21)(H2,19,20,22)/t13-/m0/s1 |
| InChIKey | JJSWAUQVAULPMZ-ZDUSSCGKSA-N |
| XLogP | 2.20 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide?
The IUPAC name of N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide (CID 97219025) is N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide.
What is the SMILES notation for N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide?
The canonical SMILES for N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide is O=C(NCCNC(=O)C1CCCC1)N[C@H](c1nccs1)C1CC1.
What is the InChIKey of N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide?
The InChIKey is JJSWAUQVAULPMZ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H24N4O2S/c21-14(12-3-1-2-4-12)17-7-8-19-16(22)20-13(11-5-6-11)15-18-9-10-23-15/h9-13H,1-8H2,(H,17,21)(H2,19,20,22)/t13-/m0/s1.
What are the key properties of N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide?
N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide has a molecular weight of 336.46 g/mol, XLogP of 2.20, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]carbamoylamino]ethyl]cyclopentanecarboxamide is sourced from PubChem (CID 97219025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).