C11H18N2S2 — CID 107133299
N-[1,3-thiazol-2-yl(thiolan-3-yl)methyl]propan-2-amine (PubChem CID 107133299) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is N-[1,3-thiazol-2-yl(thiolan-3-yl)methyl]propan-2-amine.
| Compound Name | N-[1,3-thiazol-2-yl(thiolan-3-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 107133299 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[1,3-thiazol-2-yl(thiolan-3-yl)methyl]propan-2-amine |
| SMILES | CC(C)NC(c1nccs1)C1CCSC1 |
| InChI | InChI=1S/C11H18N2S2/c1-8(2)13-10(9-3-5-14-7-9)11-12-4-6-15-11/h4,6,8-10,13H,3,5,7H2,1-2H3 |
| InChIKey | DWVJQAJKCQFWII-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |