C15H18N2OS — CID 98187618
(1R,2S,4S)-N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98187618) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is (1R,2S,4S)-N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98187618 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (1R,2S,4S)-N-[(S)-cyclopropyl(1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(N[C@H](c1nccs1)C1CC1)[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H18N2OS/c18-14(12-8-9-1-2-11(12)7-9)17-13(10-3-4-10)15-16-5-6-19-15/h1-2,5-6,9-13H,3-4,7-8H2,(H,17,18)/t9-,11-,12-,13-/m0/s1 |
| InChIKey | OJQRBGHYUKXQKL-BQUFFADESA-N |
| XLogP | 2.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|