About N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide
N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide (PubChem CID 111540388) has the molecular formula C15H16N2O2S
and a molecular weight of 288.37 g/mol. Its IUPAC name is N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide |
| PubChem CID | 111540388 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide |
| SMILES | O=C(NC(c1nccs1)C1CC1)C(O)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O2S/c18-13(11-4-2-1-3-5-11)14(19)17-12(10-6-7-10)15-16-8-9-20-15/h1-5,8-10,12-13,18H,6-7H2,(H,17,19) |
| InChIKey | NZVMGZSRYHIFIJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide?
The IUPAC name of N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide (CID 111540388) is N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide.
What is the SMILES notation for N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide?
The canonical SMILES for N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide is O=C(NC(c1nccs1)C1CC1)C(O)c1ccccc1.
What is the InChIKey of N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide?
The InChIKey is NZVMGZSRYHIFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2S/c18-13(11-4-2-1-3-5-11)14(19)17-12(10-6-7-10)15-16-8-9-20-15/h1-5,8-10,12-13,18H,6-7H2,(H,17,19).
What are the key properties of N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide?
N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide has a molecular weight of 288.37 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cyclopropyl(1,3-thiazol-2-yl)methyl]-2-hydroxy-2-phenylacetamide is sourced from PubChem (CID 111540388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).