C17H21N3O2S — CID 71992541
1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(ethoxymethyl)phenyl]urea (PubChem CID 71992541) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(ethoxymethyl)phenyl]urea.
| Compound Name | 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(ethoxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 71992541 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[cyclopropyl(1,3-thiazol-2-yl)methyl]-3-[2-(ethoxymethyl)phenyl]urea |
| SMILES | CCOCc1ccccc1NC(=O)NC(c1nccs1)C1CC1 |
| InChI | InChI=1S/C17H21N3O2S/c1-2-22-11-13-5-3-4-6-14(13)19-17(21)20-15(12-7-8-12)16-18-9-10-23-16/h3-6,9-10,12,15H,2,7-8,11H2,1H3,(H2,19,20,21) |
| InChIKey | BUPOEHNPDFOMJT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |