C16H20N2OS — CID 98351658
(1R,2R,4S)-N-[(R)-cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98351658) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is (1R,2R,4S)-N-[(R)-cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-[(R)-cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98351658 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (1R,2R,4S)-N-[(R)-cyclopropyl-(4-methyl-1,3-thiazol-2-yl)methyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | Cc1csc([C@H](NC(=O)[C@@H]2C[C@H]3C=C[C@H]2C3)C2CC2)n1 |
| InChI | InChI=1S/C16H20N2OS/c1-9-8-20-16(17-9)14(11-4-5-11)18-15(19)13-7-10-2-3-12(13)6-10/h2-3,8,10-14H,4-7H2,1H3,(H,18,19)/t10-,12-,13+,14+/m0/s1 |
| InChIKey | LWECAGKXHQOJAM-SCUASFONSA-N |
| XLogP | 3.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|