C10H18N4OS — CID 107134964
5-(oxan-3-ylsulfanyl)-4-propan-2-yl-1,2,4-triazol-3-amine (PubChem CID 107134964) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 5-(oxan-3-ylsulfanyl)-4-propan-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 5-(oxan-3-ylsulfanyl)-4-propan-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 107134964 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 5-(oxan-3-ylsulfanyl)-4-propan-2-yl-1,2,4-triazol-3-amine |
| SMILES | CC(C)n1c(N)nnc1SC1CCCOC1 |
| InChI | InChI=1S/C10H18N4OS/c1-7(2)14-9(11)12-13-10(14)16-8-4-3-5-15-6-8/h7-8H,3-6H2,1-2H3,(H2,11,12) |
| InChIKey | JRLYEIMRXBEMAG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |