C8H17N5S — CID 63095774
5-[2-(methylamino)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine (PubChem CID 63095774) has the molecular formula C8H17N5S and a molecular weight of 215.33 g/mol. Its IUPAC name is 5-[2-(methylamino)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine.
| Compound Name | 5-[2-(methylamino)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 63095774 |
| Molecular Formula | C8H17N5S |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 5-[2-(methylamino)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazol-3-amine |
| SMILES | CNCCSc1nnc(N)n1C(C)C |
| InChI | InChI=1S/C8H17N5S/c1-6(2)13-7(9)11-12-8(13)14-5-4-10-3/h6,10H,4-5H2,1-3H3,(H2,9,11) |
| InChIKey | YECOCCAMZARABI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|