C13H19NO4S — CID 107138172
4-ethoxy-2-(oxan-3-ylsulfonyl)aniline (PubChem CID 107138172) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-ethoxy-2-(oxan-3-ylsulfonyl)aniline.
| Compound Name | 4-ethoxy-2-(oxan-3-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 107138172 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-ethoxy-2-(oxan-3-ylsulfonyl)aniline |
| SMILES | CCOc1ccc(N)c(S(=O)(=O)C2CCCOC2)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-2-18-10-5-6-12(14)13(8-10)19(15,16)11-4-3-7-17-9-11/h5-6,8,11H,2-4,7,9,14H2,1H3 |
| InChIKey | AFDJEDTVCHUKNJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|