C11H14FNO3S — CID 107138203
2-fluoro-4-(oxan-3-ylsulfonyl)aniline (PubChem CID 107138203) has the molecular formula C11H14FNO3S and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-fluoro-4-(oxan-3-ylsulfonyl)aniline.
| Compound Name | 2-fluoro-4-(oxan-3-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 107138203 |
| Molecular Formula | C11H14FNO3S |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-fluoro-4-(oxan-3-ylsulfonyl)aniline |
| SMILES | Nc1ccc(S(=O)(=O)C2CCCOC2)cc1F |
| InChI | InChI=1S/C11H14FNO3S/c12-10-6-8(3-4-11(10)13)17(14,15)9-2-1-5-16-7-9/h3-4,6,9H,1-2,5,7,13H2 |
| InChIKey | WMVINVXKBIDVOF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|