C13H17F2NO2S — CID 64715064
3-(3,4-difluorophenyl)sulfonyl-N-methylcyclohexan-1-amine (PubChem CID 64715064) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)sulfonyl-N-methylcyclohexan-1-amine.
| Compound Name | 3-(3,4-difluorophenyl)sulfonyl-N-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64715064 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-(3,4-difluorophenyl)sulfonyl-N-methylcyclohexan-1-amine |
| SMILES | CNC1CCCC(S(=O)(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C13H17F2NO2S/c1-16-9-3-2-4-10(7-9)19(17,18)11-5-6-12(14)13(15)8-11/h5-6,8-10,16H,2-4,7H2,1H3 |
| InChIKey | WWJRYIYQWAYDLK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |