C12H25NO — CID 107138713
N,2-dimethyl-1-(oxan-3-yl)pentan-1-amine (PubChem CID 107138713) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is N,2-dimethyl-1-(oxan-3-yl)pentan-1-amine.
| Compound Name | N,2-dimethyl-1-(oxan-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 107138713 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | N,2-dimethyl-1-(oxan-3-yl)pentan-1-amine |
| SMILES | CCCC(C)C(NC)C1CCCOC1 |
| InChI | InChI=1S/C12H25NO/c1-4-6-10(2)12(13-3)11-7-5-8-14-9-11/h10-13H,4-9H2,1-3H3 |
| InChIKey | RCQADMPWLXWZMQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |