C10H19F2NO — CID 80604878
N-[2,2-difluoro-1-(oxan-3-yl)ethyl]propan-1-amine (PubChem CID 80604878) has the molecular formula C10H19F2NO and a molecular weight of 207.26 g/mol. Its IUPAC name is N-[2,2-difluoro-1-(oxan-3-yl)ethyl]propan-1-amine.
| Compound Name | N-[2,2-difluoro-1-(oxan-3-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 80604878 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-[2,2-difluoro-1-(oxan-3-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C(F)F)C1CCCOC1 |
| InChI | InChI=1S/C10H19F2NO/c1-2-5-13-9(10(11)12)8-4-3-6-14-7-8/h8-10,13H,2-7H2,1H3 |
| InChIKey | PQJZAWWRODRUFY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |