C11H9BrF2N2O — CID 107140055
2-bromo-2,2-difluoro-1-(1-phenylpyrazol-4-yl)ethanol (PubChem CID 107140055) has the molecular formula C11H9BrF2N2O and a molecular weight of 303.11 g/mol. Its IUPAC name is 2-bromo-2,2-difluoro-1-(1-phenylpyrazol-4-yl)ethanol.
| Compound Name | 2-bromo-2,2-difluoro-1-(1-phenylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 107140055 |
| Molecular Formula | C11H9BrF2N2O |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 2-bromo-2,2-difluoro-1-(1-phenylpyrazol-4-yl)ethanol |
| SMILES | OC(c1cnn(-c2ccccc2)c1)C(F)(F)Br |
| InChI | InChI=1S/C11H9BrF2N2O/c12-11(13,14)10(17)8-6-15-16(7-8)9-4-2-1-3-5-9/h1-7,10,17H |
| InChIKey | JTMAMNNAZUEFTA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|