C11H9F3N2O — CID 54978509
2,2,2-trifluoro-1-(1-phenylpyrazol-4-yl)ethanol (PubChem CID 54978509) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1-phenylpyrazol-4-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(1-phenylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 54978509 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2,2,2-trifluoro-1-(1-phenylpyrazol-4-yl)ethanol |
| SMILES | OC(c1cnn(-c2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O/c12-11(13,14)10(17)8-6-15-16(7-8)9-4-2-1-3-5-9/h1-7,10,17H |
| InChIKey | FFYRLQHGYWNWAI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |