C9H14BrF2NO — CID 107140522
3-[bromo(difluoro)methyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 107140522) has the molecular formula C9H14BrF2NO and a molecular weight of 270.12 g/mol. Its IUPAC name is 3-[bromo(difluoro)methyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-[bromo(difluoro)methyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 107140522 |
| Molecular Formula | C9H14BrF2NO |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 3-[bromo(difluoro)methyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CN1C2CCC1CC(O)(C(F)(F)Br)C2 |
| InChI | InChI=1S/C9H14BrF2NO/c1-13-6-2-3-7(13)5-8(14,4-6)9(10,11)12/h6-7,14H,2-5H2,1H3 |
| InChIKey | QJJNSXGYUOBESB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|