C10H19N3O2 — CID 107141424
2-[3-(4-methylpiperazin-1-yl)azetidin-3-yl]acetic acid (PubChem CID 107141424) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[3-(4-methylpiperazin-1-yl)azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(4-methylpiperazin-1-yl)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107141424 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-[3-(4-methylpiperazin-1-yl)azetidin-3-yl]acetic acid |
| SMILES | CN1CCN(C2(CC(=O)O)CNC2)CC1 |
| InChI | InChI=1S/C10H19N3O2/c1-12-2-4-13(5-3-12)10(6-9(14)15)7-11-8-10/h11H,2-8H2,1H3,(H,14,15) |
| InChIKey | UMUXJNVJTUYONX-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |