C11H17F3N2O2 — CID 107141882
2-[3-[4-(trifluoromethyl)piperidin-1-yl]azetidin-3-yl]acetic acid (PubChem CID 107141882) has the molecular formula C11H17F3N2O2 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-[3-[4-(trifluoromethyl)piperidin-1-yl]azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-[4-(trifluoromethyl)piperidin-1-yl]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107141882 |
| Molecular Formula | C11H17F3N2O2 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 2-[3-[4-(trifluoromethyl)piperidin-1-yl]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(N2CCC(C(F)(F)F)CC2)CNC1 |
| InChI | InChI=1S/C11H17F3N2O2/c12-11(13,14)8-1-3-16(4-2-8)10(5-9(17)18)6-15-7-10/h8,15H,1-7H2,(H,17,18) |
| InChIKey | GLDCDHQLWSJGHN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |