C14H18N2O4 — CID 107142143
2-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)azetidin-3-yl]acetic acid (PubChem CID 107142143) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107142143 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(Nc2ccc3c(c2)OCCCO3)CNC1 |
| InChI | InChI=1S/C14H18N2O4/c17-13(18)7-14(8-15-9-14)16-10-2-3-11-12(6-10)20-5-1-4-19-11/h2-3,6,15-16H,1,4-5,7-9H2,(H,17,18) |
| InChIKey | ROQWDQBYONKJPY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|