C10H14N4O2 — CID 107143252
2-[3-(pyridazin-3-ylmethylamino)azetidin-3-yl]acetic acid (PubChem CID 107143252) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-[3-(pyridazin-3-ylmethylamino)azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-(pyridazin-3-ylmethylamino)azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 107143252 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-[3-(pyridazin-3-ylmethylamino)azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(NCc2cccnn2)CNC1 |
| InChI | InChI=1S/C10H14N4O2/c15-9(16)4-10(6-11-7-10)12-5-8-2-1-3-13-14-8/h1-3,11-12H,4-7H2,(H,15,16) |
| InChIKey | IMXOBPQBKRCZPH-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |