C22H34N2O3 — CID 10714475
5-[(Z,17Z)-17-hydroxyiminoheptadec-5-enoyl]-1H-pyrrole-2-carbaldehyde (PubChem CID 10714475) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 5-[(Z,17Z)-17-hydroxyiminoheptadec-5-enoyl]-1H-pyrrole-2-carbaldehyde.
| Compound Name | 5-[(Z,17Z)-17-hydroxyiminoheptadec-5-enoyl]-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 10714475 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 5-[(Z,17Z)-17-hydroxyiminoheptadec-5-enoyl]-1H-pyrrole-2-carbaldehyde |
| SMILES | O=Cc1ccc(C(=O)CCC/C=C\CCCCCCCCCC/C=N\O)[nH]1 |
| InChI | InChI=1S/C22H34N2O3/c25-19-20-16-17-21(24-20)22(26)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-18-23-27/h7,9,16-19,24,27H,1-6,8,10-15H2/b9-7-,23-18- |
| InChIKey | WLASJVZSTAYOLT-MPYBJKCJSA-N |
| XLogP | 6.10 |
| TPSA | 82.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|