C30H43NO2 — CID 72798487
5-pentacosa-10,13,16,19,22-pentaenoyl-1H-pyrrole-2-carbaldehyde (PubChem CID 72798487) has the molecular formula C30H43NO2 and a molecular weight of 449.68 g/mol. Its IUPAC name is 5-pentacosa-10,13,16,19,22-pentaenoyl-1H-pyrrole-2-carbaldehyde.
| Compound Name | 5-pentacosa-10,13,16,19,22-pentaenoyl-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 72798487 |
| Molecular Formula | C30H43NO2 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | 5-pentacosa-10,13,16,19,22-pentaenoyl-1H-pyrrole-2-carbaldehyde |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCCCCCC(=O)c1ccc(C=O)[nH]1 |
| InChI | InChI=1S/C30H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-30(33)29-26-25-28(27-32)31-29/h3-4,6-7,9-10,12-13,15-16,25-27,31H,2,5,8,11,14,17-24H2,1H3 |
| InChIKey | LSLPFTRAQIKINH-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|