C16H18F3NO4S — CID 10714595
[2-[3-(1-formyl-3,4-dihydro-2H-pyridin-6-yl)propyl]phenyl] trifluoromethanesulfonate (PubChem CID 10714595) has the molecular formula C16H18F3NO4S and a molecular weight of 377.38 g/mol. Its IUPAC name is [2-[3-(1-formyl-3,4-dihydro-2H-pyridin-6-yl)propyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[3-(1-formyl-3,4-dihydro-2H-pyridin-6-yl)propyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10714595 |
| Molecular Formula | C16H18F3NO4S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [2-[3-(1-formyl-3,4-dihydro-2H-pyridin-6-yl)propyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=CN1CCCC=C1CCCc1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H18F3NO4S/c17-16(18,19)25(22,23)24-15-10-2-1-6-13(15)7-5-9-14-8-3-4-11-20(14)12-21/h1-2,6,8,10,12H,3-5,7,9,11H2 |
| InChIKey | ITDGVKUFBHRMFD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|