C20H16F9NO7S2 — CID 11365552
[2-[(1R)-1-[(2,2,2-trifluoroacetyl)-[(1R)-1-[2-(trifluoromethylsulfonyloxy)phenyl]ethyl]amino]ethyl]phenyl] trifluoromethanesulfonate (PubChem CID 11365552) has the molecular formula C20H16F9NO7S2 and a molecular weight of 617.46 g/mol. Its IUPAC name is [2-[(1R)-1-[(2,2,2-trifluoroacetyl)-[(1R)-1-[2-(trifluoromethylsulfonyloxy)phenyl]ethyl]amino]ethyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[(1R)-1-[(2,2,2-trifluoroacetyl)-[(1R)-1-[2-(trifluoromethylsulfonyloxy)phenyl]ethyl]amino]ethyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11365552 |
| Molecular Formula | C20H16F9NO7S2 |
| Molecular Weight | 617.46 g/mol |
| Exact Mass | 617.02 |
| IUPAC Name | [2-[(1R)-1-[(2,2,2-trifluoroacetyl)-[(1R)-1-[2-(trifluoromethylsulfonyloxy)phenyl]ethyl]amino]ethyl]phenyl] trifluoromethanesulfonate |
| SMILES | C[C@H](c1ccccc1OS(=O)(=O)C(F)(F)F)N(C(=O)C(F)(F)F)[C@H](C)c1ccccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H16F9NO7S2/c1-11(13-7-3-5-9-15(13)36-38(32,33)19(24,25)26)30(17(31)18(21,22)23)12(2)14-8-4-6-10-16(14)37-39(34,35)20(27,28)29/h3-12H,1-2H3/t11-,12-/m1/s1 |
| InChIKey | OATKZCRYWDEIDN-VXGBXAGGSA-N |
| XLogP | 5.36 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|