C12H22N2O4 — CID 107146846
(2S)-2-[(4-methoxypyrrolidine-2-carbonyl)amino]hexanoic acid (PubChem CID 107146846) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S)-2-[(4-methoxypyrrolidine-2-carbonyl)amino]hexanoic acid.
| Compound Name | (2S)-2-[(4-methoxypyrrolidine-2-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 107146846 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (2S)-2-[(4-methoxypyrrolidine-2-carbonyl)amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C1CC(OC)CN1)C(=O)O |
| InChI | InChI=1S/C12H22N2O4/c1-3-4-5-9(12(16)17)14-11(15)10-6-8(18-2)7-13-10/h8-10,13H,3-7H2,1-2H3,(H,14,15)(H,16,17)/t8?,9-,10?/m0/s1 |
| InChIKey | QCBYWOCOFFZTQR-KYHHOPLUSA-N |
| XLogP | 0.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |