C11H18N2O6 — CID 61214957
2-[(4-methoxypyrrolidine-2-carbonyl)amino]pentanedioic acid (PubChem CID 61214957) has the molecular formula C11H18N2O6 and a molecular weight of 274.27 g/mol. Its IUPAC name is 2-[(4-methoxypyrrolidine-2-carbonyl)amino]pentanedioic acid.
| Compound Name | 2-[(4-methoxypyrrolidine-2-carbonyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 61214957 |
| Molecular Formula | C11H18N2O6 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-[(4-methoxypyrrolidine-2-carbonyl)amino]pentanedioic acid |
| SMILES | COC1CNC(C(=O)NC(CCC(=O)O)C(=O)O)C1 |
| InChI | InChI=1S/C11H18N2O6/c1-19-6-4-8(12-5-6)10(16)13-7(11(17)18)2-3-9(14)15/h6-8,12H,2-5H2,1H3,(H,13,16)(H,14,15)(H,17,18) |
| InChIKey | SLXYFULERGSOLE-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |