C12H17NO2 — CID 107148964
2-(3,4-dihydro-1H-isochromen-4-ylamino)propan-1-ol (PubChem CID 107148964) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isochromen-4-ylamino)propan-1-ol.
| Compound Name | 2-(3,4-dihydro-1H-isochromen-4-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 107148964 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(3,4-dihydro-1H-isochromen-4-ylamino)propan-1-ol |
| SMILES | CC(CO)NC1COCc2ccccc21 |
| InChI | InChI=1S/C12H17NO2/c1-9(6-14)13-12-8-15-7-10-4-2-3-5-11(10)12/h2-5,9,12-14H,6-8H2,1H3 |
| InChIKey | FBTKUUCBABVUIA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |