C25H27N3O — CID 10715131
N-(1-benzylpiperidin-4-yl)-4,5-dihydro-1H-benzo[g]indole-3-carboxamide (PubChem CID 10715131) has the molecular formula C25H27N3O and a molecular weight of 385.51 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-4,5-dihydro-1H-benzo[g]indole-3-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-4,5-dihydro-1H-benzo[g]indole-3-carboxamide |
|---|---|
| PubChem CID | 10715131 |
| Molecular Formula | C25H27N3O |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-4,5-dihydro-1H-benzo[g]indole-3-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1c[nH]c2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C25H27N3O/c29-25(23-16-26-24-21-9-5-4-8-19(21)10-11-22(23)24)27-20-12-14-28(15-13-20)17-18-6-2-1-3-7-18/h1-9,16,20,26H,10-15,17H2,(H,27,29) |
| InChIKey | YBPUXAQDHOGGJG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |