C17H27NO — CID 107151346
1-[(3-cyclopropylphenyl)methylamino]-4,4-dimethylpentan-2-ol (PubChem CID 107151346) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-[(3-cyclopropylphenyl)methylamino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(3-cyclopropylphenyl)methylamino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107151346 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1-[(3-cyclopropylphenyl)methylamino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNCc1cccc(C2CC2)c1 |
| InChI | InChI=1S/C17H27NO/c1-17(2,3)10-16(19)12-18-11-13-5-4-6-15(9-13)14-7-8-14/h4-6,9,14,16,18-19H,7-8,10-12H2,1-3H3 |
| InChIKey | ZOTZJJXNVUVXFH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |