C13H17BrN2O4 — CID 107151855
2-bromo-N-(2-hydroxy-4-methylpentyl)-5-nitrobenzamide (PubChem CID 107151855) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is 2-bromo-N-(2-hydroxy-4-methylpentyl)-5-nitrobenzamide.
| Compound Name | 2-bromo-N-(2-hydroxy-4-methylpentyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 107151855 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-bromo-N-(2-hydroxy-4-methylpentyl)-5-nitrobenzamide |
| SMILES | CC(C)CC(O)CNC(=O)c1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C13H17BrN2O4/c1-8(2)5-10(17)7-15-13(18)11-6-9(16(19)20)3-4-12(11)14/h3-4,6,8,10,17H,5,7H2,1-2H3,(H,15,18) |
| InChIKey | MQKSGBURYCFKAM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|