C10H20F3NO — CID 107151921
4,4-dimethyl-1-(3,3,3-trifluoropropylamino)pentan-2-ol (PubChem CID 107151921) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is 4,4-dimethyl-1-(3,3,3-trifluoropropylamino)pentan-2-ol.
| Compound Name | 4,4-dimethyl-1-(3,3,3-trifluoropropylamino)pentan-2-ol |
|---|---|
| PubChem CID | 107151921 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 4,4-dimethyl-1-(3,3,3-trifluoropropylamino)pentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO/c1-9(2,3)6-8(15)7-14-5-4-10(11,12)13/h8,14-15H,4-7H2,1-3H3 |
| InChIKey | YKEHSMLTNJEKJG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|