C11H22F3NO — CID 107151968
4,4-dimethyl-1-(4,4,4-trifluorobutylamino)pentan-2-ol (PubChem CID 107151968) has the molecular formula C11H22F3NO and a molecular weight of 241.30 g/mol. Its IUPAC name is 4,4-dimethyl-1-(4,4,4-trifluorobutylamino)pentan-2-ol.
| Compound Name | 4,4-dimethyl-1-(4,4,4-trifluorobutylamino)pentan-2-ol |
|---|---|
| PubChem CID | 107151968 |
| Molecular Formula | C11H22F3NO |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 4,4-dimethyl-1-(4,4,4-trifluorobutylamino)pentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNCCCC(F)(F)F |
| InChI | InChI=1S/C11H22F3NO/c1-10(2,3)7-9(16)8-15-6-4-5-11(12,13)14/h9,15-16H,4-8H2,1-3H3 |
| InChIKey | MIVFSISEWCTQHZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|