About 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol
1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol (PubChem CID 107153199) has the molecular formula C16H22N2O
and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol |
| PubChem CID | 107153199 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNc1nccc2ccccc12 |
| InChI | InChI=1S/C16H22N2O/c1-16(2,3)10-13(19)11-18-15-14-7-5-4-6-12(14)8-9-17-15/h4-9,13,19H,10-11H2,1-3H3,(H,17,18) |
| InChIKey | PJKLQOIUWLTLAE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol?
The IUPAC name of 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol (CID 107153199) is 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol.
What is the SMILES notation for 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol?
The canonical SMILES for 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol is CC(C)(C)CC(O)CNc1nccc2ccccc12.
What is the InChIKey of 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol?
The InChIKey is PJKLQOIUWLTLAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O/c1-16(2,3)10-13(19)11-18-15-14-7-5-4-6-12(14)8-9-17-15/h4-9,13,19H,10-11H2,1-3H3,(H,17,18).
What are the key properties of 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol?
1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol has a molecular weight of 258.36 g/mol, XLogP of 3.44, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(isoquinolin-1-ylamino)-4,4-dimethylpentan-2-ol is sourced from PubChem (CID 107153199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).