C24H39NO3 — CID 10715387
[2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl]amino]-2-oxoethyl] acetate (PubChem CID 10715387) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is [2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 10715387 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | [2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenyl]amino]-2-oxoethyl] acetate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCNC(=O)COC(C)=O |
| InChI | InChI=1S/C24H39NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-24(27)22-28-23(2)26/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-22H2,1-2H3,(H,25,27)/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | DWXJVUKDOLXSRK-ZKWNWVNESA-N |
| XLogP | 5.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|