C17H32N2O3 — CID 11960566
(2-amino-2-oxoethyl) N-[(Z)-tetradec-11-enyl]carbamate (PubChem CID 11960566) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) N-[(Z)-tetradec-11-enyl]carbamate.
| Compound Name | (2-amino-2-oxoethyl) N-[(Z)-tetradec-11-enyl]carbamate |
|---|---|
| PubChem CID | 11960566 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | (2-amino-2-oxoethyl) N-[(Z)-tetradec-11-enyl]carbamate |
| SMILES | CC/C=C\CCCCCCCCCCNC(=O)OCC(N)=O |
| InChI | InChI=1S/C17H32N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-19-17(21)22-15-16(18)20/h3-4H,2,5-15H2,1H3,(H2,18,20)(H,19,21)/b4-3- |
| InChIKey | OZBSZHKKDRRFQO-ARJAWSKDSA-N |
| XLogP | 3.67 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|