C25H27ClN2 — CID 10715468
(2S)-N,N-dibenzyl-3-benzylimino-4-chlorobutan-2-amine (PubChem CID 10715468) has the molecular formula C25H27ClN2 and a molecular weight of 390.96 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-3-benzylimino-4-chlorobutan-2-amine.
| Compound Name | (2S)-N,N-dibenzyl-3-benzylimino-4-chlorobutan-2-amine |
|---|---|
| PubChem CID | 10715468 |
| Molecular Formula | C25H27ClN2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (2S)-N,N-dibenzyl-3-benzylimino-4-chlorobutan-2-amine |
| SMILES | C[C@@H](/C(CCl)=N/Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H27ClN2/c1-21(25(17-26)27-18-22-11-5-2-6-12-22)28(19-23-13-7-3-8-14-23)20-24-15-9-4-10-16-24/h2-16,21H,17-20H2,1H3/b27-25+/t21-/m0/s1 |
| InChIKey | ZSKRIYXNXVVTMH-WOSBWRHYSA-N |
| XLogP | 5.96 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|