C31H41ClN2OSi — CID 11409830
(2R)-N,N-dibenzyl-3-benzylimino-1-[tert-butyl(dimethyl)silyl]oxy-4-chlorobutan-2-amine (PubChem CID 11409830) has the molecular formula C31H41ClN2OSi and a molecular weight of 521.22 g/mol. Its IUPAC name is (2R)-N,N-dibenzyl-3-benzylimino-1-[tert-butyl(dimethyl)silyl]oxy-4-chlorobutan-2-amine.
| Compound Name | (2R)-N,N-dibenzyl-3-benzylimino-1-[tert-butyl(dimethyl)silyl]oxy-4-chlorobutan-2-amine |
|---|---|
| PubChem CID | 11409830 |
| Molecular Formula | C31H41ClN2OSi |
| Molecular Weight | 521.22 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | (2R)-N,N-dibenzyl-3-benzylimino-1-[tert-butyl(dimethyl)silyl]oxy-4-chlorobutan-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](/C(CCl)=N/Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H41ClN2OSi/c1-31(2,3)36(4,5)35-25-30(29(21-32)33-22-26-15-9-6-10-16-26)34(23-27-17-11-7-12-18-27)24-28-19-13-8-14-20-28/h6-20,30H,21-25H2,1-5H3/b33-29+/t30-/m0/s1 |
| InChIKey | CVEANTFFRGHUPI-QBJWFPPQSA-N |
| XLogP | 7.96 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.22 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|