C24H31ClN2 — CID 10619963
(2S)-N,N-dibenzyl-4-chloro-3-cyclohexyliminobutan-2-amine (PubChem CID 10619963) has the molecular formula C24H31ClN2 and a molecular weight of 382.98 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-4-chloro-3-cyclohexyliminobutan-2-amine.
| Compound Name | (2S)-N,N-dibenzyl-4-chloro-3-cyclohexyliminobutan-2-amine |
|---|---|
| PubChem CID | 10619963 |
| Molecular Formula | C24H31ClN2 |
| Molecular Weight | 382.98 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (2S)-N,N-dibenzyl-4-chloro-3-cyclohexyliminobutan-2-amine |
| SMILES | C[C@@H](/C(CCl)=N/C1CCCCC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H31ClN2/c1-20(24(17-25)26-23-15-9-4-10-16-23)27(18-21-11-5-2-6-12-21)19-22-13-7-3-8-14-22/h2-3,5-8,11-14,20,23H,4,9-10,15-19H2,1H3/b26-24+/t20-/m0/s1 |
| InChIKey | ZNIMASKPROBOMR-TVZLLBDRSA-N |
| XLogP | 6.09 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.98 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|