C28H33ClN2 — CID 10741425
(3S)-N,N-dibenzyl-2-benzylimino-1-chloro-5-methylhexan-3-amine (PubChem CID 10741425) has the molecular formula C28H33ClN2 and a molecular weight of 433.04 g/mol. Its IUPAC name is (3S)-N,N-dibenzyl-2-benzylimino-1-chloro-5-methylhexan-3-amine.
| Compound Name | (3S)-N,N-dibenzyl-2-benzylimino-1-chloro-5-methylhexan-3-amine |
|---|---|
| PubChem CID | 10741425 |
| Molecular Formula | C28H33ClN2 |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (3S)-N,N-dibenzyl-2-benzylimino-1-chloro-5-methylhexan-3-amine |
| SMILES | CC(C)C[C@@H](/C(CCl)=N/Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C28H33ClN2/c1-23(2)18-28(27(19-29)30-20-24-12-6-3-7-13-24)31(21-25-14-8-4-9-15-25)22-26-16-10-5-11-17-26/h3-17,23,28H,18-22H2,1-2H3/b30-27+/t28-/m0/s1 |
| InChIKey | IJANQZXIDRKFPP-KRMIOCCOSA-N |
| XLogP | 6.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|