C27H32N2 — CID 14791980
(2S)-N,N-dibenzyl-1-benzylimino-4-methylpentan-2-amine (PubChem CID 14791980) has the molecular formula C27H32N2 and a molecular weight of 384.57 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-1-benzylimino-4-methylpentan-2-amine.
| Compound Name | (2S)-N,N-dibenzyl-1-benzylimino-4-methylpentan-2-amine |
|---|---|
| PubChem CID | 14791980 |
| Molecular Formula | C27H32N2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | (2S)-N,N-dibenzyl-1-benzylimino-4-methylpentan-2-amine |
| SMILES | CC(C)C[C@@H](/C=N/Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H32N2/c1-23(2)18-27(20-28-19-24-12-6-3-7-13-24)29(21-25-14-8-4-9-15-25)22-26-16-10-5-11-17-26/h3-17,20,23,27H,18-19,21-22H2,1-2H3/b28-20+/t27-/m0/s1 |
| InChIKey | ZMODXRBXQZKMQI-ONNMZWHZSA-N |
| XLogP | 6.37 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|