C22H36ClNOSi — CID 23583353
(E)-N-benzyl-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-4-chloro-3-methylbut-2-en-1-amine (PubChem CID 23583353) has the molecular formula C22H36ClNOSi and a molecular weight of 394.08 g/mol. Its IUPAC name is (E)-N-benzyl-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-4-chloro-3-methylbut-2-en-1-amine.
| Compound Name | (E)-N-benzyl-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-4-chloro-3-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 23583353 |
| Molecular Formula | C22H36ClNOSi |
| Molecular Weight | 394.08 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (E)-N-benzyl-N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl]-4-chloro-3-methylbut-2-en-1-amine |
| SMILES | C=C[C@@H](CO[Si](C)(C)C(C)(C)C)N(C/C=C(\C)CCl)Cc1ccccc1 |
| InChI | InChI=1S/C22H36ClNOSi/c1-8-21(18-25-26(6,7)22(3,4)5)24(15-14-19(2)16-23)17-20-12-10-9-11-13-20/h8-14,21H,1,15-18H2,2-7H3/b19-14+/t21-/m0/s1 |
| InChIKey | BIMGYOJQDPMGJB-CURYZJDOSA-N |
| XLogP | 6.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.08 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|