C19H28F3NOSi — CID 141473828
[1-benzyl-4-(trifluoromethyl)-2,5-dihydropyrrol-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 141473828) has the molecular formula C19H28F3NOSi and a molecular weight of 371.52 g/mol. Its IUPAC name is [1-benzyl-4-(trifluoromethyl)-2,5-dihydropyrrol-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [1-benzyl-4-(trifluoromethyl)-2,5-dihydropyrrol-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 141473828 |
| Molecular Formula | C19H28F3NOSi |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [1-benzyl-4-(trifluoromethyl)-2,5-dihydropyrrol-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C=C(C(F)(F)F)CN1Cc1ccccc1 |
| InChI | InChI=1S/C19H28F3NOSi/c1-18(2,3)25(4,5)24-14-17-11-16(19(20,21)22)13-23(17)12-15-9-7-6-8-10-15/h6-11,17H,12-14H2,1-5H3 |
| InChIKey | HIZXKHJHWZYEPD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|